C24H23ClN2O2S — CID 58129247
4-chloro-N-[(4-cyanophenyl)methyl]-N-(4-phenylbutan-2-yl)benzenesulfonamide (PubChem CID 58129247) has the molecular formula C24H23ClN2O2S and a molecular weight of 438.98 g/mol. Its IUPAC name is 4-chloro-N-[(4-cyanophenyl)methyl]-N-(4-phenylbutan-2-yl)benzenesulfonamide.
| Compound Name | 4-chloro-N-[(4-cyanophenyl)methyl]-N-(4-phenylbutan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 58129247 |
| Molecular Formula | C24H23ClN2O2S |
| Molecular Weight | 438.98 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | 4-chloro-N-[(4-cyanophenyl)methyl]-N-(4-phenylbutan-2-yl)benzenesulfonamide |
| SMILES | CC(CCc1ccccc1)N(Cc1ccc(C#N)cc1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H23ClN2O2S/c1-19(7-8-20-5-3-2-4-6-20)27(18-22-11-9-21(17-26)10-12-22)30(28,29)24-15-13-23(25)14-16-24/h2-6,9-16,19H,7-8,18H2,1H3 |
| InChIKey | PDLPTXHLKFOQDY-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.98 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |