C19H24ClNO2S — CID 67367150
N-[(2R)-butan-2-yl]-4-chloro-N-(3-phenylpropyl)benzenesulfonamide (PubChem CID 67367150) has the molecular formula C19H24ClNO2S and a molecular weight of 365.93 g/mol. Its IUPAC name is N-[(2R)-butan-2-yl]-4-chloro-N-(3-phenylpropyl)benzenesulfonamide.
| Compound Name | N-[(2R)-butan-2-yl]-4-chloro-N-(3-phenylpropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 67367150 |
| Molecular Formula | C19H24ClNO2S |
| Molecular Weight | 365.93 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | N-[(2R)-butan-2-yl]-4-chloro-N-(3-phenylpropyl)benzenesulfonamide |
| SMILES | CC[C@@H](C)N(CCCc1ccccc1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H24ClNO2S/c1-3-16(2)21(15-7-10-17-8-5-4-6-9-17)24(22,23)19-13-11-18(20)12-14-19/h4-6,8-9,11-14,16H,3,7,10,15H2,1-2H3/t16-/m1/s1 |
| InChIKey | QMBTUOBMMBKUKK-MRXNPFEDSA-N |
| XLogP | 4.76 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.93 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |