C20H26ClNO2S — CID 124567549
N-[(2R)-butan-2-yl]-4-chloro-N-[(3R)-3-phenylbutyl]benzenesulfonamide (PubChem CID 124567549) has the molecular formula C20H26ClNO2S and a molecular weight of 379.95 g/mol. Its IUPAC name is N-[(2R)-butan-2-yl]-4-chloro-N-[(3R)-3-phenylbutyl]benzenesulfonamide.
| Compound Name | N-[(2R)-butan-2-yl]-4-chloro-N-[(3R)-3-phenylbutyl]benzenesulfonamide |
|---|---|
| PubChem CID | 124567549 |
| Molecular Formula | C20H26ClNO2S |
| Molecular Weight | 379.95 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | N-[(2R)-butan-2-yl]-4-chloro-N-[(3R)-3-phenylbutyl]benzenesulfonamide |
| SMILES | CC[C@@H](C)N(CC[C@@H](C)c1ccccc1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H26ClNO2S/c1-4-17(3)22(15-14-16(2)18-8-6-5-7-9-18)25(23,24)20-12-10-19(21)11-13-20/h5-13,16-17H,4,14-15H2,1-3H3/t16-,17-/m1/s1 |
| InChIKey | PHFJYSFIMQIQJS-IAGOWNOFSA-N |
| XLogP | 5.32 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.95 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |