C20H24ClNO2S — CID 11632263
4-chloro-N-pentan-3-yl-N-[(E)-3-phenylprop-2-enyl]benzenesulfonamide (PubChem CID 11632263) has the molecular formula C20H24ClNO2S and a molecular weight of 377.94 g/mol. Its IUPAC name is 4-chloro-N-pentan-3-yl-N-[(E)-3-phenylprop-2-enyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-pentan-3-yl-N-[(E)-3-phenylprop-2-enyl]benzenesulfonamide |
|---|---|
| PubChem CID | 11632263 |
| Molecular Formula | C20H24ClNO2S |
| Molecular Weight | 377.94 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 4-chloro-N-pentan-3-yl-N-[(E)-3-phenylprop-2-enyl]benzenesulfonamide |
| SMILES | CCC(CC)N(C/C=C/c1ccccc1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H24ClNO2S/c1-3-19(4-2)22(16-8-11-17-9-6-5-7-10-17)25(23,24)20-14-12-18(21)13-15-20/h5-15,19H,3-4,16H2,1-2H3/b11-8+ |
| InChIKey | XGVBLDDEHBQBFC-DHZHZOJOSA-N |
| XLogP | 5.23 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.94 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |