C18H26ClNO5S — CID 67369690
ethyl (E)-4-[(4-chlorophenyl)sulfonyl-(1-hydroxy-4-methylpentan-2-yl)amino]but-2-enoate (PubChem CID 67369690) has the molecular formula C18H26ClNO5S and a molecular weight of 403.93 g/mol. Its IUPAC name is ethyl (E)-4-[(4-chlorophenyl)sulfonyl-(1-hydroxy-4-methylpentan-2-yl)amino]but-2-enoate.
| Compound Name | ethyl (E)-4-[(4-chlorophenyl)sulfonyl-(1-hydroxy-4-methylpentan-2-yl)amino]but-2-enoate |
|---|---|
| PubChem CID | 67369690 |
| Molecular Formula | C18H26ClNO5S |
| Molecular Weight | 403.93 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | ethyl (E)-4-[(4-chlorophenyl)sulfonyl-(1-hydroxy-4-methylpentan-2-yl)amino]but-2-enoate |
| SMILES | CCOC(=O)/C=C/CN(C(CO)CC(C)C)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H26ClNO5S/c1-4-25-18(22)6-5-11-20(16(13-21)12-14(2)3)26(23,24)17-9-7-15(19)8-10-17/h5-10,14,16,21H,4,11-13H2,1-3H3/b6-5+ |
| InChIKey | RDHLIHODHKDIFQ-AATRIKPKSA-N |
| XLogP | 2.86 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.93 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|