C17H26ClNO3S — CID 67368681
4-chloro-N-(1-hydroxy-4-methylpentan-2-yl)-N-(3-methylbut-2-enyl)benzenesulfonamide (PubChem CID 67368681) has the molecular formula C17H26ClNO3S and a molecular weight of 359.92 g/mol. Its IUPAC name is 4-chloro-N-(1-hydroxy-4-methylpentan-2-yl)-N-(3-methylbut-2-enyl)benzenesulfonamide.
| Compound Name | 4-chloro-N-(1-hydroxy-4-methylpentan-2-yl)-N-(3-methylbut-2-enyl)benzenesulfonamide |
|---|---|
| PubChem CID | 67368681 |
| Molecular Formula | C17H26ClNO3S |
| Molecular Weight | 359.92 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 4-chloro-N-(1-hydroxy-4-methylpentan-2-yl)-N-(3-methylbut-2-enyl)benzenesulfonamide |
| SMILES | CC(C)=CCN(C(CO)CC(C)C)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H26ClNO3S/c1-13(2)9-10-19(16(12-20)11-14(3)4)23(21,22)17-7-5-15(18)6-8-17/h5-9,14,16,20H,10-12H2,1-4H3 |
| InChIKey | CRHUDJLVPIECKW-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.92 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|