C17H17ClO2S — CID 155934408
1-chloro-4-[(E,3S)-1-phenylpent-1-en-3-yl]sulfonylbenzene (PubChem CID 155934408) has the molecular formula C17H17ClO2S and a molecular weight of 320.84 g/mol. Its IUPAC name is 1-chloro-4-[(E,3S)-1-phenylpent-1-en-3-yl]sulfonylbenzene.
| Compound Name | 1-chloro-4-[(E,3S)-1-phenylpent-1-en-3-yl]sulfonylbenzene |
|---|---|
| PubChem CID | 155934408 |
| Molecular Formula | C17H17ClO2S |
| Molecular Weight | 320.84 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 1-chloro-4-[(E,3S)-1-phenylpent-1-en-3-yl]sulfonylbenzene |
| SMILES | CC[C@@H](/C=C/c1ccccc1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H17ClO2S/c1-2-16(11-8-14-6-4-3-5-7-14)21(19,20)17-12-9-15(18)10-13-17/h3-13,16H,2H2,1H3/b11-8+/t16-/m0/s1 |
| InChIKey | OJCBMEKLNQNUIU-KXKDPZRNSA-N |
| XLogP | 4.61 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.84 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |