C19H22O3S — CID 155934559
[(E,3S)-3-(benzenesulfonyl)-6-methoxyhex-1-enyl]benzene (PubChem CID 155934559) has the molecular formula C19H22O3S and a molecular weight of 330.45 g/mol. Its IUPAC name is [(E,3S)-3-(benzenesulfonyl)-6-methoxyhex-1-enyl]benzene.
| Compound Name | [(E,3S)-3-(benzenesulfonyl)-6-methoxyhex-1-enyl]benzene |
|---|---|
| PubChem CID | 155934559 |
| Molecular Formula | C19H22O3S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | [(E,3S)-3-(benzenesulfonyl)-6-methoxyhex-1-enyl]benzene |
| SMILES | COCCC[C@@H](/C=C/c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H22O3S/c1-22-16-8-13-19(15-14-17-9-4-2-5-10-17)23(20,21)18-11-6-3-7-12-18/h2-7,9-12,14-15,19H,8,13,16H2,1H3/b15-14+/t19-/m0/s1 |
| InChIKey | ZWGUABYOYOLVDQ-IQGVVSCOSA-N |
| XLogP | 3.97 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|