C17H16O4S — CID 102182706
[(E,1S)-1-(benzenesulfonyl)-3-phenylprop-2-enyl] acetate (PubChem CID 102182706) has the molecular formula C17H16O4S and a molecular weight of 316.38 g/mol. Its IUPAC name is [(E,1S)-1-(benzenesulfonyl)-3-phenylprop-2-enyl] acetate.
| Compound Name | [(E,1S)-1-(benzenesulfonyl)-3-phenylprop-2-enyl] acetate |
|---|---|
| PubChem CID | 102182706 |
| Molecular Formula | C17H16O4S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | [(E,1S)-1-(benzenesulfonyl)-3-phenylprop-2-enyl] acetate |
| SMILES | CC(=O)O[C@H](/C=C/c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H16O4S/c1-14(18)21-17(13-12-15-8-4-2-5-9-15)22(19,20)16-10-6-3-7-11-16/h2-13,17H,1H3/b13-12+/t17-/m0/s1 |
| InChIKey | ADWJLTMCESKDOH-UJGDBWEASA-N |
| XLogP | 3.06 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |