C17H15NO6S — CID 102182707
[(E,1S)-1-(benzenesulfonyl)-3-(2-nitrophenyl)prop-2-enyl] acetate (PubChem CID 102182707) has the molecular formula C17H15NO6S and a molecular weight of 361.38 g/mol. Its IUPAC name is [(E,1S)-1-(benzenesulfonyl)-3-(2-nitrophenyl)prop-2-enyl] acetate.
| Compound Name | [(E,1S)-1-(benzenesulfonyl)-3-(2-nitrophenyl)prop-2-enyl] acetate |
|---|---|
| PubChem CID | 102182707 |
| Molecular Formula | C17H15NO6S |
| Molecular Weight | 361.38 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | [(E,1S)-1-(benzenesulfonyl)-3-(2-nitrophenyl)prop-2-enyl] acetate |
| SMILES | CC(=O)O[C@H](/C=C/c1ccccc1[N+](=O)[O-])S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H15NO6S/c1-13(19)24-17(25(22,23)15-8-3-2-4-9-15)12-11-14-7-5-6-10-16(14)18(20)21/h2-12,17H,1H3/b12-11+/t17-/m0/s1 |
| InChIKey | BORMCDKALCTBKE-FLVLSHQESA-N |
| XLogP | 2.97 |
| TPSA | 103.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|