C32H28N2O8S — CID 87211098
1-[(E)-3-(4-methoxyphenyl)-3-[(E)-1-(4-methoxyphenyl)-3-(2-nitrophenyl)prop-2-enyl]sulfonylprop-1-enyl]-2-nitrobenzene (PubChem CID 87211098) has the molecular formula C32H28N2O8S and a molecular weight of 600.65 g/mol. Its IUPAC name is 1-[(E)-3-(4-methoxyphenyl)-3-[(E)-1-(4-methoxyphenyl)-3-(2-nitrophenyl)prop-2-enyl]sulfonylprop-1-enyl]-2-nitrobenzene.
| Compound Name | 1-[(E)-3-(4-methoxyphenyl)-3-[(E)-1-(4-methoxyphenyl)-3-(2-nitrophenyl)prop-2-enyl]sulfonylprop-1-enyl]-2-nitrobenzene |
|---|---|
| PubChem CID | 87211098 |
| Molecular Formula | C32H28N2O8S |
| Molecular Weight | 600.65 g/mol |
| Exact Mass | 600.16 |
| IUPAC Name | 1-[(E)-3-(4-methoxyphenyl)-3-[(E)-1-(4-methoxyphenyl)-3-(2-nitrophenyl)prop-2-enyl]sulfonylprop-1-enyl]-2-nitrobenzene |
| SMILES | COc1ccc(C(/C=C/c2ccccc2[N+](=O)[O-])S(=O)(=O)C(/C=C/c2ccccc2[N+](=O)[O-])c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C32H28N2O8S/c1-41-27-17-11-25(12-18-27)31(21-15-23-7-3-5-9-29(23)33(35)36)43(39,40)32(26-13-19-28(42-2)20-14-26)22-16-24-8-4-6-10-30(24)34(37)38/h3-22,31-32H,1-2H3/b21-15+,22-16+ |
| InChIKey | SDVHNJRZXOLEOR-YHARCJFQSA-N |
| XLogP | 7.14 |
| TPSA | 138.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.65 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|