C38H40N2O14S — CID 142801189
1,3,5-trimethoxy-2-[3-(4-methoxy-3-nitrophenyl)-3-[1-(4-methoxy-3-nitrophenyl)-3-(2,4,6-trimethoxyphenyl)prop-2-enyl]sulfonylprop-1-enyl]benzene (PubChem CID 142801189) has the molecular formula C38H40N2O14S and a molecular weight of 780.80 g/mol. Its IUPAC name is 1,3,5-trimethoxy-2-[3-(4-methoxy-3-nitrophenyl)-3-[1-(4-methoxy-3-nitrophenyl)-3-(2,4,6-trimethoxyphenyl)prop-2-enyl]sulfonylprop-1-enyl]benzene.
| Compound Name | 1,3,5-trimethoxy-2-[3-(4-methoxy-3-nitrophenyl)-3-[1-(4-methoxy-3-nitrophenyl)-3-(2,4,6-trimethoxyphenyl)prop-2-enyl]sulfonylprop-1-enyl]benzene |
|---|---|
| PubChem CID | 142801189 |
| Molecular Formula | C38H40N2O14S |
| Molecular Weight | 780.80 g/mol |
| Exact Mass | 780.22 |
| IUPAC Name | 1,3,5-trimethoxy-2-[3-(4-methoxy-3-nitrophenyl)-3-[1-(4-methoxy-3-nitrophenyl)-3-(2,4,6-trimethoxyphenyl)prop-2-enyl]sulfonylprop-1-enyl]benzene |
| SMILES | COc1cc(OC)c(C=CC(c2ccc(OC)c([N+](=O)[O-])c2)S(=O)(=O)C(C=Cc2c(OC)cc(OC)cc2OC)c2ccc(OC)c([N+](=O)[O-])c2)c(OC)c1 |
| InChI | InChI=1S/C38H40N2O14S/c1-47-25-19-33(51-5)27(34(20-25)52-6)11-15-37(23-9-13-31(49-3)29(17-23)39(41)42)55(45,46)38(24-10-14-32(50-4)30(18-24)40(43)44)16-12-28-35(53-7)21-26(48-2)22-36(28)54-8/h9-22,37-38H,1-8H3 |
| InChIKey | BEUNVYWEHTWEOQ-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 194.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.80 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|