C25H27NO8 — CID 11662781
1,3,5-trimethoxy-2-[(4-nitrophenyl)-(2,4,6-trimethoxyphenyl)methyl]benzene (PubChem CID 11662781) has the molecular formula C25H27NO8 and a molecular weight of 469.49 g/mol. Its IUPAC name is 1,3,5-trimethoxy-2-[(4-nitrophenyl)-(2,4,6-trimethoxyphenyl)methyl]benzene.
| Compound Name | 1,3,5-trimethoxy-2-[(4-nitrophenyl)-(2,4,6-trimethoxyphenyl)methyl]benzene |
|---|---|
| PubChem CID | 11662781 |
| Molecular Formula | C25H27NO8 |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | 1,3,5-trimethoxy-2-[(4-nitrophenyl)-(2,4,6-trimethoxyphenyl)methyl]benzene |
| SMILES | COc1cc(OC)c(C(c2ccc([N+](=O)[O-])cc2)c2c(OC)cc(OC)cc2OC)c(OC)c1 |
| InChI | InChI=1S/C25H27NO8/c1-29-17-11-19(31-3)24(20(12-17)32-4)23(15-7-9-16(10-8-15)26(27)28)25-21(33-5)13-18(30-2)14-22(25)34-6/h7-14,23H,1-6H3 |
| InChIKey | XIWVKYWXKOWCFS-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 98.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|