C31H27NO8 — CID 10721199
2-[(1-hydroxy-4,8-dimethoxynaphthalen-2-yl)-(4-nitrophenyl)methyl]-4,8-dimethoxynaphthalen-1-ol (PubChem CID 10721199) has the molecular formula C31H27NO8 and a molecular weight of 541.56 g/mol. Its IUPAC name is 2-[(1-hydroxy-4,8-dimethoxynaphthalen-2-yl)-(4-nitrophenyl)methyl]-4,8-dimethoxynaphthalen-1-ol.
| Compound Name | 2-[(1-hydroxy-4,8-dimethoxynaphthalen-2-yl)-(4-nitrophenyl)methyl]-4,8-dimethoxynaphthalen-1-ol |
|---|---|
| PubChem CID | 10721199 |
| Molecular Formula | C31H27NO8 |
| Molecular Weight | 541.56 g/mol |
| Exact Mass | 541.17 |
| IUPAC Name | 2-[(1-hydroxy-4,8-dimethoxynaphthalen-2-yl)-(4-nitrophenyl)methyl]-4,8-dimethoxynaphthalen-1-ol |
| SMILES | COc1cc(C(c2ccc([N+](=O)[O-])cc2)c2cc(OC)c3cccc(OC)c3c2O)c(O)c2c(OC)cccc12 |
| InChI | InChI=1S/C31H27NO8/c1-37-23-9-5-7-19-25(39-3)15-21(30(33)28(19)23)27(17-11-13-18(14-12-17)32(35)36)22-16-26(40-4)20-8-6-10-24(38-2)29(20)31(22)34/h5-16,27,33-34H,1-4H3 |
| InChIKey | FVEFZOWNBZZZKC-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 120.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.56 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|