C20H21NO8 — CID 42656821
ethyl 2-(4-nitrophenyl)-3-oxo-3-(2,4,5-trimethoxyphenyl)propanoate (PubChem CID 42656821) has the molecular formula C20H21NO8 and a molecular weight of 403.39 g/mol. Its IUPAC name is ethyl 2-(4-nitrophenyl)-3-oxo-3-(2,4,5-trimethoxyphenyl)propanoate.
| Compound Name | ethyl 2-(4-nitrophenyl)-3-oxo-3-(2,4,5-trimethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 42656821 |
| Molecular Formula | C20H21NO8 |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | ethyl 2-(4-nitrophenyl)-3-oxo-3-(2,4,5-trimethoxyphenyl)propanoate |
| SMILES | CCOC(=O)C(C(=O)c1cc(OC)c(OC)cc1OC)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H21NO8/c1-5-29-20(23)18(12-6-8-13(9-7-12)21(24)25)19(22)14-10-16(27-3)17(28-4)11-15(14)26-2/h6-11,18H,5H2,1-4H3 |
| InChIKey | FNLVQJVVQQFOIP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 114.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|