C14H15Br2NO7 — CID 22222573
ethyl 2,3-dibromo-4-(4,5-dimethoxy-2-nitrophenyl)-4-oxobutanoate (PubChem CID 22222573) has the molecular formula C14H15Br2NO7 and a molecular weight of 469.08 g/mol. Its IUPAC name is ethyl 2,3-dibromo-4-(4,5-dimethoxy-2-nitrophenyl)-4-oxobutanoate.
| Compound Name | ethyl 2,3-dibromo-4-(4,5-dimethoxy-2-nitrophenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 22222573 |
| Molecular Formula | C14H15Br2NO7 |
| Molecular Weight | 469.08 g/mol |
| Exact Mass | 466.92 |
| IUPAC Name | ethyl 2,3-dibromo-4-(4,5-dimethoxy-2-nitrophenyl)-4-oxobutanoate |
| SMILES | CCOC(=O)C(Br)C(Br)C(=O)c1cc(OC)c(OC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H15Br2NO7/c1-4-24-14(19)12(16)11(15)13(18)7-5-9(22-2)10(23-3)6-8(7)17(20)21/h5-6,11-12H,4H2,1-3H3 |
| InChIKey | WWAQSVGFVNIDMS-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.08 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|