C15H21NO8 — CID 11186961
ethyl 4,5-bis(2-methoxyethoxy)-2-nitrobenzoate (PubChem CID 11186961) has the molecular formula C15H21NO8 and a molecular weight of 343.33 g/mol. Its IUPAC name is ethyl 4,5-bis(2-methoxyethoxy)-2-nitrobenzoate.
| Compound Name | ethyl 4,5-bis(2-methoxyethoxy)-2-nitrobenzoate |
|---|---|
| PubChem CID | 11186961 |
| Molecular Formula | C15H21NO8 |
| Molecular Weight | 343.33 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | ethyl 4,5-bis(2-methoxyethoxy)-2-nitrobenzoate |
| SMILES | CCOC(=O)c1cc(OCCOC)c(OCCOC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H21NO8/c1-4-22-15(17)11-9-13(23-7-5-20-2)14(24-8-6-21-3)10-12(11)16(18)19/h9-10H,4-8H2,1-3H3 |
| InChIKey | VOHOFZNVWZWVMA-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 106.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.33 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|