C17H29NO6 — CID 143274795
ethane;ethyl 2-amino-4,5-bis(2-methoxyethoxy)benzoate (PubChem CID 143274795) has the molecular formula C17H29NO6 and a molecular weight of 343.42 g/mol. Its IUPAC name is ethane;ethyl 2-amino-4,5-bis(2-methoxyethoxy)benzoate.
| Compound Name | ethane;ethyl 2-amino-4,5-bis(2-methoxyethoxy)benzoate |
|---|---|
| PubChem CID | 143274795 |
| Molecular Formula | C17H29NO6 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | ethane;ethyl 2-amino-4,5-bis(2-methoxyethoxy)benzoate |
| SMILES | CC.CCOC(=O)c1cc(OCCOC)c(OCCOC)cc1N |
| InChI | InChI=1S/C15H23NO6.C2H6/c1-4-20-15(17)11-9-13(21-7-5-18-2)14(10-12(11)16)22-8-6-19-3;1-2/h9-10H,4-8,16H2,1-3H3;1-2H3 |
| InChIKey | ZNNHRAIQMJVVSI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 89.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|