About sodium;hydride;2-methoxy-5-nitrophenol
sodium;hydride;2-methoxy-5-nitrophenol (PubChem CID 173002361) has the molecular formula C7H8NNaO4
and a molecular weight of 193.13 g/mol. Its IUPAC name is sodium;hydride;2-methoxy-5-nitrophenol.
Molecular Properties
| Compound Name | sodium;hydride;2-methoxy-5-nitrophenol |
| PubChem CID | 173002361 |
| Molecular Formula | C7H8NNaO4 |
| Molecular Weight | 193.13 g/mol |
| Exact Mass | 193.04 |
| IUPAC Name | sodium;hydride;2-methoxy-5-nitrophenol |
| SMILES | COc1ccc([N+](=O)[O-])cc1O.[H-].[Na+] |
| InChI | InChI=1S/C7H7NO4.Na.H/c1-12-7-3-2-5(8(10)11)4-6(7)9;;/h2-4,9H,1H3;;/q;+1;-1 |
| InChIKey | OBUNIQOZSPKVCJ-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.13 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;2-methoxy-5-nitrophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;2-methoxy-5-nitrophenol?
The IUPAC name of sodium;hydride;2-methoxy-5-nitrophenol (CID 173002361) is sodium;hydride;2-methoxy-5-nitrophenol.
What is the SMILES notation for sodium;hydride;2-methoxy-5-nitrophenol?
The canonical SMILES for sodium;hydride;2-methoxy-5-nitrophenol is COc1ccc([N+](=O)[O-])cc1O.[H-].[Na+].
What is the InChIKey of sodium;hydride;2-methoxy-5-nitrophenol?
The InChIKey is OBUNIQOZSPKVCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO4.Na.H/c1-12-7-3-2-5(8(10)11)4-6(7)9;;/h2-4,9H,1H3;;/q;+1;-1.
What are the key properties of sodium;hydride;2-methoxy-5-nitrophenol?
sodium;hydride;2-methoxy-5-nitrophenol has a molecular weight of 193.13 g/mol, XLogP of -1.57, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;2-methoxy-5-nitrophenol is sourced from PubChem (CID 173002361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).