About 3-hydroxy-4-methoxybenzaldehyde;4-nitrobenzaldehyde
3-hydroxy-4-methoxybenzaldehyde;4-nitrobenzaldehyde (PubChem CID 87894032) has the molecular formula C15H13NO6
and a molecular weight of 303.27 g/mol. Its IUPAC name is 3-hydroxy-4-methoxybenzaldehyde;4-nitrobenzaldehyde.
Molecular Properties
| Compound Name | 3-hydroxy-4-methoxybenzaldehyde;4-nitrobenzaldehyde |
| PubChem CID | 87894032 |
| Molecular Formula | C15H13NO6 |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 3-hydroxy-4-methoxybenzaldehyde;4-nitrobenzaldehyde |
| SMILES | COc1ccc(C=O)cc1O.O=Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C8H8O3.C7H5NO3/c1-11-8-3-2-6(5-9)4-7(8)10;9-5-6-1-3-7(4-2-6)8(10)11/h2-5,10H,1H3;1-5H |
| InChIKey | NGWGGJINAKMXFL-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 106.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxy-4-methoxybenzaldehyde;4-nitrobenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-4-methoxybenzaldehyde;4-nitrobenzaldehyde?
The IUPAC name of 3-hydroxy-4-methoxybenzaldehyde;4-nitrobenzaldehyde (CID 87894032) is 3-hydroxy-4-methoxybenzaldehyde;4-nitrobenzaldehyde.
What is the SMILES notation for 3-hydroxy-4-methoxybenzaldehyde;4-nitrobenzaldehyde?
The canonical SMILES for 3-hydroxy-4-methoxybenzaldehyde;4-nitrobenzaldehyde is COc1ccc(C=O)cc1O.O=Cc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of 3-hydroxy-4-methoxybenzaldehyde;4-nitrobenzaldehyde?
The InChIKey is NGWGGJINAKMXFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O3.C7H5NO3/c1-11-8-3-2-6(5-9)4-7(8)10;9-5-6-1-3-7(4-2-6)8(10)11/h2-5,10H,1H3;1-5H.
What are the key properties of 3-hydroxy-4-methoxybenzaldehyde;4-nitrobenzaldehyde?
3-hydroxy-4-methoxybenzaldehyde;4-nitrobenzaldehyde has a molecular weight of 303.27 g/mol, XLogP of 2.62, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-4-methoxybenzaldehyde;4-nitrobenzaldehyde is sourced from PubChem (CID 87894032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).