(4-formyl-2-methoxyphenyl) nitrate

C8H7NO5 — CID 22323696

IUPAC(4-formyl-2-methoxyphenyl) nitrate
SMILESCOc1cc(C=O)ccc1O[N+](=O)[O-]
InChIInChI=1S/C8H7NO5/c1-13-8-4-6(5-10)2-3-7(8)14-9(11)12/h2-5H,1H3
InChIKeyMWRBDZZMLQYJFY-UHFFFAOYSA-N
MW197.15 g/mol
LogP1.08
Rot. Bonds4

About (4-formyl-2-methoxyphenyl) nitrate

(4-formyl-2-methoxyphenyl) nitrate (PubChem CID 22323696) has the molecular formula C8H7NO5 and a molecular weight of 197.15 g/mol. Its IUPAC name is (4-formyl-2-methoxyphenyl) nitrate.

Molecular Properties

Compound Name(4-formyl-2-methoxyphenyl) nitrate
PubChem CID22323696
Molecular FormulaC8H7NO5
Molecular Weight197.15 g/mol
Exact Mass197.03
IUPAC Name(4-formyl-2-methoxyphenyl) nitrate
SMILESCOc1cc(C=O)ccc1O[N+](=O)[O-]
InChIInChI=1S/C8H7NO5/c1-13-8-4-6(5-10)2-3-7(8)14-9(11)12/h2-5H,1H3
InChIKeyMWRBDZZMLQYJFY-UHFFFAOYSA-N
XLogP1.08
TPSA78.67 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500197.15
LogP ≤ 51.08
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze (4-formyl-2-methoxyphenyl) nitrate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4-formyl-2-methoxyphenyl) nitrate?
The IUPAC name of (4-formyl-2-methoxyphenyl) nitrate (CID 22323696) is (4-formyl-2-methoxyphenyl) nitrate.
What is the SMILES notation for (4-formyl-2-methoxyphenyl) nitrate?
The canonical SMILES for (4-formyl-2-methoxyphenyl) nitrate is COc1cc(C=O)ccc1O[N+](=O)[O-].
What is the InChIKey of (4-formyl-2-methoxyphenyl) nitrate?
The InChIKey is MWRBDZZMLQYJFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO5/c1-13-8-4-6(5-10)2-3-7(8)14-9(11)12/h2-5H,1H3.
What are the key properties of (4-formyl-2-methoxyphenyl) nitrate?
(4-formyl-2-methoxyphenyl) nitrate has a molecular weight of 197.15 g/mol, XLogP of 1.08, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-formyl-2-methoxyphenyl) nitrate is sourced from PubChem (CID 22323696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).