About dichloromethane;2-methoxy-4-nitrophenol
dichloromethane;2-methoxy-4-nitrophenol (PubChem CID 141183892) has the molecular formula C8H9Cl2NO4
and a molecular weight of 254.07 g/mol. Its IUPAC name is dichloromethane;2-methoxy-4-nitrophenol.
Molecular Properties
| Compound Name | dichloromethane;2-methoxy-4-nitrophenol |
| PubChem CID | 141183892 |
| Molecular Formula | C8H9Cl2NO4 |
| Molecular Weight | 254.07 g/mol |
| Exact Mass | 252.99 |
| IUPAC Name | dichloromethane;2-methoxy-4-nitrophenol |
| SMILES | COc1cc([N+](=O)[O-])ccc1O.ClCCl |
| InChI | InChI=1S/C7H7NO4.CH2Cl2/c1-12-7-4-5(8(10)11)2-3-6(7)9;2-1-3/h2-4,9H,1H3;1H2 |
| InChIKey | GPBRRLWOOUACLO-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.07 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze dichloromethane;2-methoxy-4-nitrophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloromethane;2-methoxy-4-nitrophenol?
The IUPAC name of dichloromethane;2-methoxy-4-nitrophenol (CID 141183892) is dichloromethane;2-methoxy-4-nitrophenol.
What is the SMILES notation for dichloromethane;2-methoxy-4-nitrophenol?
The canonical SMILES for dichloromethane;2-methoxy-4-nitrophenol is COc1cc([N+](=O)[O-])ccc1O.ClCCl.
What is the InChIKey of dichloromethane;2-methoxy-4-nitrophenol?
The InChIKey is GPBRRLWOOUACLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO4.CH2Cl2/c1-12-7-4-5(8(10)11)2-3-6(7)9;2-1-3/h2-4,9H,1H3;1H2.
What are the key properties of dichloromethane;2-methoxy-4-nitrophenol?
dichloromethane;2-methoxy-4-nitrophenol has a molecular weight of 254.07 g/mol, XLogP of 2.73, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dichloromethane;2-methoxy-4-nitrophenol is sourced from PubChem (CID 141183892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).