C22H22O4 — CID 10315870
[(1E,3R)-1-phenylhexa-1,5-dien-3-yl] (2S)-2-acetyloxy-2-phenylacetate (PubChem CID 10315870) has the molecular formula C22H22O4 and a molecular weight of 350.41 g/mol. Its IUPAC name is [(1E,3R)-1-phenylhexa-1,5-dien-3-yl] (2S)-2-acetyloxy-2-phenylacetate.
| Compound Name | [(1E,3R)-1-phenylhexa-1,5-dien-3-yl] (2S)-2-acetyloxy-2-phenylacetate |
|---|---|
| PubChem CID | 10315870 |
| Molecular Formula | C22H22O4 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | [(1E,3R)-1-phenylhexa-1,5-dien-3-yl] (2S)-2-acetyloxy-2-phenylacetate |
| SMILES | C=CC[C@H](/C=C/c1ccccc1)OC(=O)[C@@H](OC(C)=O)c1ccccc1 |
| InChI | InChI=1S/C22H22O4/c1-3-10-20(16-15-18-11-6-4-7-12-18)26-22(24)21(25-17(2)23)19-13-8-5-9-14-19/h3-9,11-16,20-21H,1,10H2,2H3/b16-15+/t20-,21+/m1/s1 |
| InChIKey | XHXHKGSBQXOKCS-NHQVPKDKSA-N |
| XLogP | 4.49 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|