About benzaldehyde;1-phenylbut-3-en-1-ol;prop-2-enyl acetate
benzaldehyde;1-phenylbut-3-en-1-ol;prop-2-enyl acetate (PubChem CID 161019757) has the molecular formula C22H26O4
and a molecular weight of 354.45 g/mol. Its IUPAC name is benzaldehyde;1-phenylbut-3-en-1-ol;prop-2-enyl acetate.
Molecular Properties
| Compound Name | benzaldehyde;1-phenylbut-3-en-1-ol;prop-2-enyl acetate |
| PubChem CID | 161019757 |
| Molecular Formula | C22H26O4 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | benzaldehyde;1-phenylbut-3-en-1-ol;prop-2-enyl acetate |
| SMILES | C=CCC(O)c1ccccc1.C=CCOC(C)=O.O=Cc1ccccc1 |
| InChI | InChI=1S/C10H12O.C7H6O.C5H8O2/c1-2-6-10(11)9-7-4-3-5-8-9;8-6-7-4-2-1-3-5-7;1-3-4-7-5(2)6/h2-5,7-8,10-11H,1,6H2;1-6H;3H,1,4H2,2H3 |
| InChIKey | TYFBDEXZIFYMOS-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze benzaldehyde;1-phenylbut-3-en-1-ol;prop-2-enyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzaldehyde;1-phenylbut-3-en-1-ol;prop-2-enyl acetate?
The IUPAC name of benzaldehyde;1-phenylbut-3-en-1-ol;prop-2-enyl acetate (CID 161019757) is benzaldehyde;1-phenylbut-3-en-1-ol;prop-2-enyl acetate.
What is the SMILES notation for benzaldehyde;1-phenylbut-3-en-1-ol;prop-2-enyl acetate?
The canonical SMILES for benzaldehyde;1-phenylbut-3-en-1-ol;prop-2-enyl acetate is C=CCC(O)c1ccccc1.C=CCOC(C)=O.O=Cc1ccccc1.
What is the InChIKey of benzaldehyde;1-phenylbut-3-en-1-ol;prop-2-enyl acetate?
The InChIKey is TYFBDEXZIFYMOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O.C7H6O.C5H8O2/c1-2-6-10(11)9-7-4-3-5-8-9;8-6-7-4-2-1-3-5-7;1-3-4-7-5(2)6/h2-5,7-8,10-11H,1,6H2;1-6H;3H,1,4H2,2H3.
What are the key properties of benzaldehyde;1-phenylbut-3-en-1-ol;prop-2-enyl acetate?
benzaldehyde;1-phenylbut-3-en-1-ol;prop-2-enyl acetate has a molecular weight of 354.45 g/mol, XLogP of 4.53, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzaldehyde;1-phenylbut-3-en-1-ol;prop-2-enyl acetate is sourced from PubChem (CID 161019757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).