C26H35BO4 — CID 160630591
benzaldehyde;1-phenylbut-3-en-1-ol;4,4,5,5-tetramethyl-2-prop-2-enyl-1,3,2-dioxaborolane (PubChem CID 160630591) has the molecular formula C26H35BO4 and a molecular weight of 422.37 g/mol. Its IUPAC name is benzaldehyde;1-phenylbut-3-en-1-ol;4,4,5,5-tetramethyl-2-prop-2-enyl-1,3,2-dioxaborolane.
| Compound Name | benzaldehyde;1-phenylbut-3-en-1-ol;4,4,5,5-tetramethyl-2-prop-2-enyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 160630591 |
| Molecular Formula | C26H35BO4 |
| Molecular Weight | 422.37 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | benzaldehyde;1-phenylbut-3-en-1-ol;4,4,5,5-tetramethyl-2-prop-2-enyl-1,3,2-dioxaborolane |
| SMILES | C=CCB1OC(C)(C)C(C)(C)O1.C=CCC(O)c1ccccc1.O=Cc1ccccc1 |
| InChI | InChI=1S/C10H12O.C9H17BO2.C7H6O/c1-2-6-10(11)9-7-4-3-5-8-9;1-6-7-10-11-8(2,3)9(4,5)12-10;8-6-7-4-2-1-3-5-7/h2-5,7-8,10-11H,1,6H2;6H,1,7H2,2-5H3;1-6H |
| InChIKey | RHWIUSYMIMCFIU-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.37 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|