C27H35BO2 — CID 177485824
2-[(2Z)-2,3-dibenzylhepta-2,6-dienyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 177485824) has the molecular formula C27H35BO2 and a molecular weight of 402.39 g/mol. Its IUPAC name is 2-[(2Z)-2,3-dibenzylhepta-2,6-dienyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(2Z)-2,3-dibenzylhepta-2,6-dienyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 177485824 |
| Molecular Formula | C27H35BO2 |
| Molecular Weight | 402.39 g/mol |
| Exact Mass | 402.27 |
| IUPAC Name | 2-[(2Z)-2,3-dibenzylhepta-2,6-dienyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | C=CCC/C(Cc1ccccc1)=C(\CB1OC(C)(C)C(C)(C)O1)Cc1ccccc1 |
| InChI | InChI=1S/C27H35BO2/c1-6-7-18-24(19-22-14-10-8-11-15-22)25(20-23-16-12-9-13-17-23)21-28-29-26(2,3)27(4,5)30-28/h6,8-17H,1,7,18-21H2,2-5H3/b25-24+ |
| InChIKey | IXHKFRKLMBGBLY-OCOZRVBESA-N |
| XLogP | 6.83 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.39 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|