C21H32B2O5 — CID 134903770
4,4,5,5-tetramethyl-2-[(E)-1-phenoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-en-2-yl]-1,3,2-dioxaborolane (PubChem CID 134903770) has the molecular formula C21H32B2O5 and a molecular weight of 386.11 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[(E)-1-phenoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-en-2-yl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[(E)-1-phenoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-en-2-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 134903770 |
| Molecular Formula | C21H32B2O5 |
| Molecular Weight | 386.11 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[(E)-1-phenoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-en-2-yl]-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(C/C(=C/Oc2ccccc2)B2OC(C)(C)C(C)(C)O2)OC1(C)C |
| InChI | InChI=1S/C21H32B2O5/c1-18(2)19(3,4)26-22(25-18)14-16(15-24-17-12-10-9-11-13-17)23-27-20(5,6)21(7,8)28-23/h9-13,15H,14H2,1-8H3/b16-15- |
| InChIKey | ZROXCFWCHVTWLP-NXVVXOECSA-N |
| XLogP | 4.67 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.11 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|