C16H25BO4 — CID 132529374
1-phenoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butan-2-ol (PubChem CID 132529374) has the molecular formula C16H25BO4 and a molecular weight of 292.18 g/mol. Its IUPAC name is 1-phenoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butan-2-ol.
| Compound Name | 1-phenoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butan-2-ol |
|---|---|
| PubChem CID | 132529374 |
| Molecular Formula | C16H25BO4 |
| Molecular Weight | 292.18 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 1-phenoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butan-2-ol |
| SMILES | CC1(C)OB(CCC(O)COc2ccccc2)OC1(C)C |
| InChI | InChI=1S/C16H25BO4/c1-15(2)16(3,4)21-17(20-15)11-10-13(18)12-19-14-8-6-5-7-9-14/h5-9,13,18H,10-12H2,1-4H3 |
| InChIKey | XPLZMFYPPIEBII-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.18 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|