C17H25BO2 — CID 66553482
4,4,5,5-tetramethyl-2-[(Z)-1-phenylpent-1-en-2-yl]-1,3,2-dioxaborolane (PubChem CID 66553482) has the molecular formula C17H25BO2 and a molecular weight of 272.20 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[(Z)-1-phenylpent-1-en-2-yl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[(Z)-1-phenylpent-1-en-2-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 66553482 |
| Molecular Formula | C17H25BO2 |
| Molecular Weight | 272.20 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[(Z)-1-phenylpent-1-en-2-yl]-1,3,2-dioxaborolane |
| SMILES | CCC/C(=C\c1ccccc1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C17H25BO2/c1-6-10-15(13-14-11-8-7-9-12-14)18-19-16(2,3)17(4,5)20-18/h7-9,11-13H,6,10H2,1-5H3/b15-13+ |
| InChIKey | OULLMWBEOMPSDT-FYWRMAATSA-N |
| XLogP | 4.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.20 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|