C21H31BO2 — CID 102415954
2-[(E,4E)-4-benzylideneoct-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 102415954) has the molecular formula C21H31BO2 and a molecular weight of 326.29 g/mol. Its IUPAC name is 2-[(E,4E)-4-benzylideneoct-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(E,4E)-4-benzylideneoct-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 102415954 |
| Molecular Formula | C21H31BO2 |
| Molecular Weight | 326.29 g/mol |
| Exact Mass | 326.24 |
| IUPAC Name | 2-[(E,4E)-4-benzylideneoct-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCCC/C(=C\c1ccccc1)C/C=C/B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C21H31BO2/c1-6-7-12-18(17-19-13-9-8-10-14-19)15-11-16-22-23-20(2,3)21(4,5)24-22/h8-11,13-14,16-17H,6-7,12,15H2,1-5H3/b16-11+,18-17+ |
| InChIKey | RLAJOHAJTGMXAQ-WZIHJMEJSA-N |
| XLogP | 5.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.29 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|