C27H47BO2Sn — CID 177404903
tributyl-[(Z)-3-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]stannane (PubChem CID 177404903) has the molecular formula C27H47BO2Sn and a molecular weight of 533.19 g/mol. Its IUPAC name is tributyl-[(Z)-3-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]stannane.
| Compound Name | tributyl-[(Z)-3-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]stannane |
|---|---|
| PubChem CID | 177404903 |
| Molecular Formula | C27H47BO2Sn |
| Molecular Weight | 533.19 g/mol |
| Exact Mass | 534.27 |
| IUPAC Name | tributyl-[(Z)-3-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)C/C(=C\c1ccccc1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C15H20BO2.3C4H9.Sn/c1-12(11-13-9-7-6-8-10-13)16-17-14(2,3)15(4,5)18-16;3*1-3-4-2;/h6-11H,1H2,2-5H3;3*1,3-4H2,2H3;/b12-11+;;;; |
| InChIKey | MFWKMWKZPMTGFQ-MOSUJMLHSA-N |
| XLogP | 8.55 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.19 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|