C19H34B2O6 — CID 134903901
ethyl (Z)-4,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-3-enoate (PubChem CID 134903901) has the molecular formula C19H34B2O6 and a molecular weight of 380.10 g/mol. Its IUPAC name is ethyl (Z)-4,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-3-enoate.
| Compound Name | ethyl (Z)-4,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-3-enoate |
|---|---|
| PubChem CID | 134903901 |
| Molecular Formula | C19H34B2O6 |
| Molecular Weight | 380.10 g/mol |
| Exact Mass | 380.25 |
| IUPAC Name | ethyl (Z)-4,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-3-enoate |
| SMILES | CCOC(=O)C/C=C(\CB1OC(C)(C)C(C)(C)O1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C19H34B2O6/c1-10-23-15(22)12-11-14(21-26-18(6,7)19(8,9)27-21)13-20-24-16(2,3)17(4,5)25-20/h11H,10,12-13H2,1-9H3/b14-11+ |
| InChIKey | KSEHZCIHLOENDW-SDNWHVSQSA-N |
| XLogP | 3.59 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.10 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|