C14H25BO3 — CID 11184301
2-[(1E)-1-ethoxy-4-methylpenta-1,3-dienyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 11184301) has the molecular formula C14H25BO3 and a molecular weight of 252.16 g/mol. Its IUPAC name is 2-[(1E)-1-ethoxy-4-methylpenta-1,3-dienyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(1E)-1-ethoxy-4-methylpenta-1,3-dienyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 11184301 |
| Molecular Formula | C14H25BO3 |
| Molecular Weight | 252.16 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | 2-[(1E)-1-ethoxy-4-methylpenta-1,3-dienyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCO/C(=C/C=C(C)C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C14H25BO3/c1-8-16-12(10-9-11(2)3)15-17-13(4,5)14(6,7)18-15/h9-10H,8H2,1-7H3/b12-10+ |
| InChIKey | VEQQSZVKZHEOQL-ZRDIBKRKSA-N |
| XLogP | 3.50 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.16 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|