C15H27BO4 — CID 102140931
[(Z)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-2-enyl] acetate (PubChem CID 102140931) has the molecular formula C15H27BO4 and a molecular weight of 282.19 g/mol. Its IUPAC name is [(Z)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-2-enyl] acetate.
| Compound Name | [(Z)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-2-enyl] acetate |
|---|---|
| PubChem CID | 102140931 |
| Molecular Formula | C15H27BO4 |
| Molecular Weight | 282.19 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | [(Z)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-2-enyl] acetate |
| SMILES | CCCC/C(=C\COC(C)=O)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C15H27BO4/c1-7-8-9-13(10-11-18-12(2)17)16-19-14(3,4)15(5,6)20-16/h10H,7-9,11H2,1-6H3/b13-10+ |
| InChIKey | NYNASUTXURDOIF-JLHYYAGUSA-N |
| XLogP | 3.30 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.19 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|