C22H43BO5Si — CID 11384778
[(Z)-8-[tert-butyl(dimethyl)silyl]oxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oct-5-enyl] acetate (PubChem CID 11384778) has the molecular formula C22H43BO5Si and a molecular weight of 426.48 g/mol. Its IUPAC name is [(Z)-8-[tert-butyl(dimethyl)silyl]oxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oct-5-enyl] acetate.
| Compound Name | [(Z)-8-[tert-butyl(dimethyl)silyl]oxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oct-5-enyl] acetate |
|---|---|
| PubChem CID | 11384778 |
| Molecular Formula | C22H43BO5Si |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.30 |
| IUPAC Name | [(Z)-8-[tert-butyl(dimethyl)silyl]oxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oct-5-enyl] acetate |
| SMILES | CC(=O)OCCCC/C=C(\CCO[Si](C)(C)C(C)(C)C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C22H43BO5Si/c1-18(24)25-16-13-11-12-14-19(15-17-26-29(9,10)20(2,3)4)23-27-21(5,6)22(7,8)28-23/h14H,11-13,15-17H2,1-10H3/b19-14+ |
| InChIKey | SAGJWAYBQIELBL-XMHGGMMESA-N |
| XLogP | 5.69 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|