C25H45BO4 — CID 140735216
[(E)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oct-6-enyl] undec-10-enoate (PubChem CID 140735216) has the molecular formula C25H45BO4 and a molecular weight of 420.44 g/mol. Its IUPAC name is [(E)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oct-6-enyl] undec-10-enoate.
| Compound Name | [(E)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oct-6-enyl] undec-10-enoate |
|---|---|
| PubChem CID | 140735216 |
| Molecular Formula | C25H45BO4 |
| Molecular Weight | 420.44 g/mol |
| Exact Mass | 420.34 |
| IUPAC Name | [(E)-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oct-6-enyl] undec-10-enoate |
| SMILES | C=CCCCCCCCCC(=O)OCCCCC/C=C(/C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C25H45BO4/c1-7-8-9-10-11-12-13-17-20-23(27)28-21-18-15-14-16-19-22(2)26-29-24(3,4)25(5,6)30-26/h7,19H,1,8-18,20-21H2,2-6H3/b22-19- |
| InChIKey | YVJAODZOTVPQDP-QOCHGBHMSA-N |
| XLogP | 6.97 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.44 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|