C17H32BNO4 — CID 163711791
tert-butyl N-[(Z)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-3-enyl]carbamate (PubChem CID 163711791) has the molecular formula C17H32BNO4 and a molecular weight of 325.26 g/mol. Its IUPAC name is tert-butyl N-[(Z)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-3-enyl]carbamate.
| Compound Name | tert-butyl N-[(Z)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-3-enyl]carbamate |
|---|---|
| PubChem CID | 163711791 |
| Molecular Formula | C17H32BNO4 |
| Molecular Weight | 325.26 g/mol |
| Exact Mass | 325.24 |
| IUPAC Name | tert-butyl N-[(Z)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hex-3-enyl]carbamate |
| SMILES | CC/C=C(\CCNC(=O)OC(C)(C)C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C17H32BNO4/c1-9-10-13(11-12-19-14(20)21-15(2,3)4)18-22-16(5,6)17(7,8)23-18/h10H,9,11-12H2,1-8H3,(H,19,20)/b13-10+ |
| InChIKey | KJXHDAILKFVRBY-JLHYYAGUSA-N |
| XLogP | 3.87 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.26 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|