C18H34BNO4 — CID 174043370
tert-butyl N-[(E)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-3-en-4-yl]carbamate (PubChem CID 174043370) has the molecular formula C18H34BNO4 and a molecular weight of 339.29 g/mol. Its IUPAC name is tert-butyl N-[(E)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-3-en-4-yl]carbamate.
| Compound Name | tert-butyl N-[(E)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-3-en-4-yl]carbamate |
|---|---|
| PubChem CID | 174043370 |
| Molecular Formula | C18H34BNO4 |
| Molecular Weight | 339.29 g/mol |
| Exact Mass | 339.26 |
| IUPAC Name | tert-butyl N-[(E)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-3-en-4-yl]carbamate |
| SMILES | CC/C=C(\CC(C)B1OC(C)(C)C(C)(C)O1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H34BNO4/c1-10-11-14(20-15(21)22-16(3,4)5)12-13(2)19-23-17(6,7)18(8,9)24-19/h11,13H,10,12H2,1-9H3,(H,20,21)/b14-11+ |
| InChIKey | BYDLWMOJUZWHFF-SDNWHVSQSA-N |
| XLogP | 4.68 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.29 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|