C18H35BN2O5 — CID 149117099
tert-butyl N-[1-[[2-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]amino]-1-oxopropan-2-yl]carbamate (PubChem CID 149117099) has the molecular formula C18H35BN2O5 and a molecular weight of 370.30 g/mol. Its IUPAC name is tert-butyl N-[1-[[2-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]amino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[2-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]amino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 149117099 |
| Molecular Formula | C18H35BN2O5 |
| Molecular Weight | 370.30 g/mol |
| Exact Mass | 370.26 |
| IUPAC Name | tert-butyl N-[1-[[2-methyl-1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propyl]amino]-1-oxopropan-2-yl]carbamate |
| SMILES | CC(NC(=O)OC(C)(C)C)C(=O)NC(B1OC(C)(C)C(C)(C)O1)C(C)C |
| InChI | InChI=1S/C18H35BN2O5/c1-11(2)13(19-25-17(7,8)18(9,10)26-19)21-14(22)12(3)20-15(23)24-16(4,5)6/h11-13H,1-10H3,(H,20,23)(H,21,22) |
| InChIKey | QYTWPAHUBKRNCP-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.30 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|