C18H27BFNO4 — CID 154719648
tert-butyl N-[(R)-(4-fluorophenyl)-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]carbamate (PubChem CID 154719648) has the molecular formula C18H27BFNO4 and a molecular weight of 351.23 g/mol. Its IUPAC name is tert-butyl N-[(R)-(4-fluorophenyl)-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]carbamate.
| Compound Name | tert-butyl N-[(R)-(4-fluorophenyl)-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]carbamate |
|---|---|
| PubChem CID | 154719648 |
| Molecular Formula | C18H27BFNO4 |
| Molecular Weight | 351.23 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | tert-butyl N-[(R)-(4-fluorophenyl)-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](B1OC(C)(C)C(C)(C)O1)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H27BFNO4/c1-16(2,3)23-15(22)21-14(12-8-10-13(20)11-9-12)19-24-17(4,5)18(6,7)25-19/h8-11,14H,1-7H3,(H,21,22)/t14-/m0/s1 |
| InChIKey | WXNWSJCNUNLYOQ-AWEZNQCLSA-N |
| XLogP | 4.02 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.23 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|