C19H34BNO5 — CID 102364793
methyl (Z)-2-morpholin-4-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oct-3-enoate (PubChem CID 102364793) has the molecular formula C19H34BNO5 and a molecular weight of 367.30 g/mol. Its IUPAC name is methyl (Z)-2-morpholin-4-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oct-3-enoate.
| Compound Name | methyl (Z)-2-morpholin-4-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oct-3-enoate |
|---|---|
| PubChem CID | 102364793 |
| Molecular Formula | C19H34BNO5 |
| Molecular Weight | 367.30 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | methyl (Z)-2-morpholin-4-yl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oct-3-enoate |
| SMILES | CCCC/C(=C\C(C(=O)OC)N1CCOCC1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C19H34BNO5/c1-7-8-9-15(20-25-18(2,3)19(4,5)26-20)14-16(17(22)23-6)21-10-12-24-13-11-21/h14,16H,7-13H2,1-6H3/b15-14+ |
| InChIKey | KAAHZSGGSOPMHY-CCEZHUSRSA-N |
| XLogP | 2.61 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.30 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|