C24H35BO6 — CID 101495363
dimethyl 2-[(E)-1-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-2-enyl]propanedioate (PubChem CID 101495363) has the molecular formula C24H35BO6 and a molecular weight of 430.35 g/mol. Its IUPAC name is dimethyl 2-[(E)-1-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-2-enyl]propanedioate.
| Compound Name | dimethyl 2-[(E)-1-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-2-enyl]propanedioate |
|---|---|
| PubChem CID | 101495363 |
| Molecular Formula | C24H35BO6 |
| Molecular Weight | 430.35 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | dimethyl 2-[(E)-1-phenyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hept-2-enyl]propanedioate |
| SMILES | CCCC/C=C(\B1OC(C)(C)C(C)(C)O1)C(c1ccccc1)C(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C24H35BO6/c1-8-9-11-16-18(25-30-23(2,3)24(4,5)31-25)19(17-14-12-10-13-15-17)20(21(26)28-6)22(27)29-7/h10,12-16,19-20H,8-9,11H2,1-7H3/b18-16- |
| InChIKey | MBXHFZWISVXTAI-VLGSPTGOSA-N |
| XLogP | 4.48 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.35 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|