C20H34O2Si — CID 101192098
(2S,3R)-3-methoxy-2-phenyl-1-trimethylsilyldecan-1-one (PubChem CID 101192098) has the molecular formula C20H34O2Si and a molecular weight of 334.58 g/mol. Its IUPAC name is (2S,3R)-3-methoxy-2-phenyl-1-trimethylsilyldecan-1-one.
| Compound Name | (2S,3R)-3-methoxy-2-phenyl-1-trimethylsilyldecan-1-one |
|---|---|
| PubChem CID | 101192098 |
| Molecular Formula | C20H34O2Si |
| Molecular Weight | 334.58 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | (2S,3R)-3-methoxy-2-phenyl-1-trimethylsilyldecan-1-one |
| SMILES | CCCCCCC[C@@H](OC)[C@@H](C(=O)[Si](C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C20H34O2Si/c1-6-7-8-9-13-16-18(22-2)19(20(21)23(3,4)5)17-14-11-10-12-15-17/h10-12,14-15,18-19H,6-9,13,16H2,1-5H3/t18-,19+/m1/s1 |
| InChIKey | DCMQOJMKXUBNAI-MOPGFXCFSA-N |
| XLogP | 5.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.58 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|