C22H34BNO4 — CID 102364792
methyl (Z)-2-(benzylamino)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oct-3-enoate (PubChem CID 102364792) has the molecular formula C22H34BNO4 and a molecular weight of 387.33 g/mol. Its IUPAC name is methyl (Z)-2-(benzylamino)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oct-3-enoate.
| Compound Name | methyl (Z)-2-(benzylamino)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oct-3-enoate |
|---|---|
| PubChem CID | 102364792 |
| Molecular Formula | C22H34BNO4 |
| Molecular Weight | 387.33 g/mol |
| Exact Mass | 387.26 |
| IUPAC Name | methyl (Z)-2-(benzylamino)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oct-3-enoate |
| SMILES | CCCC/C(=C\C(NCc1ccccc1)C(=O)OC)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C22H34BNO4/c1-7-8-14-18(23-27-21(2,3)22(4,5)28-23)15-19(20(25)26-6)24-16-17-12-10-9-11-13-17/h9-13,15,19,24H,7-8,14,16H2,1-6H3/b18-15+ |
| InChIKey | AARGJWRTOAYPLP-OBGWFSINSA-N |
| XLogP | 4.07 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.33 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|