C13H25BO4 — CID 75487151
ethyl 3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butanoate (PubChem CID 75487151) has the molecular formula C13H25BO4 and a molecular weight of 256.15 g/mol. Its IUPAC name is ethyl 3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butanoate.
| Compound Name | ethyl 3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butanoate |
|---|---|
| PubChem CID | 75487151 |
| Molecular Formula | C13H25BO4 |
| Molecular Weight | 256.15 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | ethyl 3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butanoate |
| SMILES | CCOC(=O)C(B1OC(C)(C)C(C)(C)O1)C(C)C |
| InChI | InChI=1S/C13H25BO4/c1-8-16-11(15)10(9(2)3)14-17-12(4,5)13(6,7)18-14/h9-10H,8H2,1-7H3 |
| InChIKey | MSYJIEUSBKFHHM-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.15 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|