C12H25BClNO4 — CID 155820282
ethyl 4-amino-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butanoate;hydrochloride (PubChem CID 155820282) has the molecular formula C12H25BClNO4 and a molecular weight of 293.60 g/mol. Its IUPAC name is ethyl 4-amino-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butanoate;hydrochloride.
| Compound Name | ethyl 4-amino-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butanoate;hydrochloride |
|---|---|
| PubChem CID | 155820282 |
| Molecular Formula | C12H25BClNO4 |
| Molecular Weight | 293.60 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | ethyl 4-amino-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)butanoate;hydrochloride |
| SMILES | CCOC(=O)CC(CN)B1OC(C)(C)C(C)(C)O1.Cl |
| InChI | InChI=1S/C12H24BNO4.ClH/c1-6-16-10(15)7-9(8-14)13-17-11(2,3)12(4,5)18-13;/h9H,6-8,14H2,1-5H3;1H |
| InChIKey | RWXKDXGBFXCOSK-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.60 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|