C16H31BO4 — CID 135062572
ethyl 3,5-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoate (PubChem CID 135062572) has the molecular formula C16H31BO4 and a molecular weight of 298.23 g/mol. Its IUPAC name is ethyl 3,5-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoate.
| Compound Name | ethyl 3,5-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoate |
|---|---|
| PubChem CID | 135062572 |
| Molecular Formula | C16H31BO4 |
| Molecular Weight | 298.23 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | ethyl 3,5-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)hexanoate |
| SMILES | CCOC(=O)CC(C)(CC(C)C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C16H31BO4/c1-9-19-13(18)11-16(8,10-12(2)3)17-20-14(4,5)15(6,7)21-17/h12H,9-11H2,1-8H3 |
| InChIKey | DDQHFXMFDBTQCF-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.23 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|