C14H28O6 — CID 87429052
ethyl 3,3-bis(2-methylpropylperoxy)butanoate (PubChem CID 87429052) has the molecular formula C14H28O6 and a molecular weight of 292.37 g/mol. Its IUPAC name is ethyl 3,3-bis(2-methylpropylperoxy)butanoate.
| Compound Name | ethyl 3,3-bis(2-methylpropylperoxy)butanoate |
|---|---|
| PubChem CID | 87429052 |
| Molecular Formula | C14H28O6 |
| Molecular Weight | 292.37 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | ethyl 3,3-bis(2-methylpropylperoxy)butanoate |
| SMILES | CCOC(=O)CC(C)(OOCC(C)C)OOCC(C)C |
| InChI | InChI=1S/C14H28O6/c1-7-16-13(15)8-14(6,19-17-9-11(2)3)20-18-10-12(4)5/h11-12H,7-10H2,1-6H3 |
| InChIKey | KSHWWVSIQVSMDS-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.37 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|