C13H27NO2 — CID 61001690
ethyl 2,4-dimethyl-2-(2-methylpropylamino)pentanoate (PubChem CID 61001690) has the molecular formula C13H27NO2 and a molecular weight of 229.36 g/mol. Its IUPAC name is ethyl 2,4-dimethyl-2-(2-methylpropylamino)pentanoate.
| Compound Name | ethyl 2,4-dimethyl-2-(2-methylpropylamino)pentanoate |
|---|---|
| PubChem CID | 61001690 |
| Molecular Formula | C13H27NO2 |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | ethyl 2,4-dimethyl-2-(2-methylpropylamino)pentanoate |
| SMILES | CCOC(=O)C(C)(CC(C)C)NCC(C)C |
| InChI | InChI=1S/C13H27NO2/c1-7-16-12(15)13(6,8-10(2)3)14-9-11(4)5/h10-11,14H,7-9H2,1-6H3 |
| InChIKey | BAYXDUSDRVSLRW-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |