C11H24N2O3 — CID 66178652
4,4-dimethoxy-2-methyl-2-(2-methylpropylamino)butanamide (PubChem CID 66178652) has the molecular formula C11H24N2O3 and a molecular weight of 232.32 g/mol. Its IUPAC name is 4,4-dimethoxy-2-methyl-2-(2-methylpropylamino)butanamide.
| Compound Name | 4,4-dimethoxy-2-methyl-2-(2-methylpropylamino)butanamide |
|---|---|
| PubChem CID | 66178652 |
| Molecular Formula | C11H24N2O3 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | 4,4-dimethoxy-2-methyl-2-(2-methylpropylamino)butanamide |
| SMILES | COC(CC(C)(NCC(C)C)C(N)=O)OC |
| InChI | InChI=1S/C11H24N2O3/c1-8(2)7-13-11(3,10(12)14)6-9(15-4)16-5/h8-9,13H,6-7H2,1-5H3,(H2,12,14) |
| InChIKey | NFNPVOXQDHKKJC-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|